Organic acids and derivatives
Filtered Search Results
Diethyl fumarate, 98%
CAS: 623-91-6 Molecular Formula: C8H12O4 Molecular Weight (g/mol): 172.18 MDL Number: MFCD00064455 InChI Key: IEPRKVQEAMIZSS-AATRIKPKSA-N Synonym: diethyl fumarate,fumaric acid, diethyl ester,anti-psoriaticum,diethyl 2e-but-2-enedioate,fumaric acid diethyl ester,diethyl e-but-2-enedioate,2-butenedioic acid e-, diethyl ester,trans-2-butenedioic acid diethyl ester,2-butenedioic acid 2e-, diethyl ester,unii-5wbu5a3e8a PubChem CID: 638144 ChEBI: CHEBI:87388 IUPAC Name: diethyl (E)-but-2-enedioate SMILES: CCOC(=O)\C=C\C(=O)OCC
| PubChem CID | 638144 |
|---|---|
| CAS | 623-91-6 |
| Molecular Weight (g/mol) | 172.18 |
| ChEBI | CHEBI:87388 |
| MDL Number | MFCD00064455 |
| SMILES | CCOC(=O)\C=C\C(=O)OCC |
| Synonym | diethyl fumarate,fumaric acid, diethyl ester,anti-psoriaticum,diethyl 2e-but-2-enedioate,fumaric acid diethyl ester,diethyl e-but-2-enedioate,2-butenedioic acid e-, diethyl ester,trans-2-butenedioic acid diethyl ester,2-butenedioic acid 2e-, diethyl ester,unii-5wbu5a3e8a |
| IUPAC Name | diethyl (E)-but-2-enedioate |
| InChI Key | IEPRKVQEAMIZSS-AATRIKPKSA-N |
| Molecular Formula | C8H12O4 |
DL-Tropic acid, 98%
CAS: 552-63-6 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00004255 InChI Key: JACRWUWPXAESPB-UHFFFAOYNA-N Synonym: tropic acid,dl-tropic acid,2-phenylhydracrylic acid,3-hydroxy-2-phenylpropionic acid,+--tropic acid,tropate,alpha-hydroxymethyl benzeneacetic acid,beta-hydroxyhydratropic acid,hydracrylic acid, 2-phenyl,alpha-hydroxymethyl phenylacetic acid PubChem CID: 10726 ChEBI: CHEBI:30765 IUPAC Name: 3-hydroxy-2-phenylpropanoic acid SMILES: OCC(C(O)=O)C1=CC=CC=C1
| PubChem CID | 10726 |
|---|---|
| CAS | 552-63-6 |
| Molecular Weight (g/mol) | 166.18 |
| ChEBI | CHEBI:30765 |
| MDL Number | MFCD00004255 |
| SMILES | OCC(C(O)=O)C1=CC=CC=C1 |
| Synonym | tropic acid,dl-tropic acid,2-phenylhydracrylic acid,3-hydroxy-2-phenylpropionic acid,+--tropic acid,tropate,alpha-hydroxymethyl benzeneacetic acid,beta-hydroxyhydratropic acid,hydracrylic acid, 2-phenyl,alpha-hydroxymethyl phenylacetic acid |
| IUPAC Name | 3-hydroxy-2-phenylpropanoic acid |
| InChI Key | JACRWUWPXAESPB-UHFFFAOYNA-N |
| Molecular Formula | C9H10O3 |
Methyl propionate, 99%
CAS: 554-12-1 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.106 MDL Number: MFCD00009306 InChI Key: RJUFJBKOKNCXHH-UHFFFAOYSA-N Synonym: methyl propionate,propanoic acid, methyl ester,methyl propylate,methylpropionate,propionic acid, methyl ester,propionate de methyle,propanoic acid methyl ester,fema number 2742,propionic acid methyl ester,methyl propionate natural PubChem CID: 11124 IUPAC Name: methyl propanoate SMILES: CCC(=O)OC
| PubChem CID | 11124 |
|---|---|
| CAS | 554-12-1 |
| Molecular Weight (g/mol) | 88.106 |
| MDL Number | MFCD00009306 |
| SMILES | CCC(=O)OC |
| Synonym | methyl propionate,propanoic acid, methyl ester,methyl propylate,methylpropionate,propionic acid, methyl ester,propionate de methyle,propanoic acid methyl ester,fema number 2742,propionic acid methyl ester,methyl propionate natural |
| IUPAC Name | methyl propanoate |
| InChI Key | RJUFJBKOKNCXHH-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
Disodium DL-Malate Hydrate 98.0+%, TCI America™
CAS: 676-46-0 Molecular Formula: C4H4Na2O5 Molecular Weight (g/mol): 178.051 MDL Number: MFCD00012466 InChI Key: WPUMTJGUQUYPIV-UHFFFAOYSA-L Synonym: disodium malate,sodium malate,disodium dl-malate,dl-malic acid disodium salt,disodium 2-hydroxybutanedioate,natriummalat german,sodium dl-malate,butanedioic acid, hydroxy-, disodium salt,malic acid, disodium salt,sodium dl-maleate PubChem CID: 8736 IUPAC Name: disodium;2-hydroxybutanedioate SMILES: C(C(C(=O)[O-])O)C(=O)[O-].[Na+].[Na+]
| PubChem CID | 8736 |
|---|---|
| CAS | 676-46-0 |
| Molecular Weight (g/mol) | 178.051 |
| MDL Number | MFCD00012466 |
| SMILES | C(C(C(=O)[O-])O)C(=O)[O-].[Na+].[Na+] |
| Synonym | disodium malate,sodium malate,disodium dl-malate,dl-malic acid disodium salt,disodium 2-hydroxybutanedioate,natriummalat german,sodium dl-malate,butanedioic acid, hydroxy-, disodium salt,malic acid, disodium salt,sodium dl-maleate |
| IUPAC Name | disodium;2-hydroxybutanedioate |
| InChI Key | WPUMTJGUQUYPIV-UHFFFAOYSA-L |
| Molecular Formula | C4H4Na2O5 |
N,N-Dimethylacrylamide, 98%, stab. with 100ppm 4-methoxyph enol
CAS: 2680-03-7 Molecular Formula: C5H9NO Molecular Weight (g/mol): 99.13 MDL Number: MFCD00008626 InChI Key: YLGYACDQVQQZSW-UHFFFAOYSA-N Synonym: n,n-dimethylacrylamide,2-propenamide, n,n-dimethyl,acrylamide, n,n-dimethyl,acylamide, n,n-dimethyl,n,n-dimethyl-acrylamide,n,n-dimethyl-2-propenamide,dimethylamid kyseliny akrylove,nn-dimethylacrylamide,unii-as46jk7q6i,propenamide, n,n-dimethyl PubChem CID: 17587 IUPAC Name: N,N-dimethylprop-2-enamide SMILES: CN(C)C(=O)C=C
| PubChem CID | 17587 |
|---|---|
| CAS | 2680-03-7 |
| Molecular Weight (g/mol) | 99.13 |
| MDL Number | MFCD00008626 |
| SMILES | CN(C)C(=O)C=C |
| Synonym | n,n-dimethylacrylamide,2-propenamide, n,n-dimethyl,acrylamide, n,n-dimethyl,acylamide, n,n-dimethyl,n,n-dimethyl-acrylamide,n,n-dimethyl-2-propenamide,dimethylamid kyseliny akrylove,nn-dimethylacrylamide,unii-as46jk7q6i,propenamide, n,n-dimethyl |
| IUPAC Name | N,N-dimethylprop-2-enamide |
| InChI Key | YLGYACDQVQQZSW-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO |
n-Propyl decanoate, 98%
CAS: 30673-60-0 Molecular Formula: C13H26O2 Molecular Weight (g/mol): 214.349 MDL Number: MFCD00056329 InChI Key: OVFMRFMJVFDSAA-UHFFFAOYSA-N Synonym: n-propyl decanoate,decanoic acid, propyl ester,propyl caprate,capric acid propyl ester,unii-s0he9grs1w,decanoic acid, propylester,s0he9grs1w,propyl caprate natural,propyl caprate decanoate,n-propyldecanoate PubChem CID: 121739 ChEBI: CHEBI:86973 IUPAC Name: propyl decanoate SMILES: CCCCCCCCCC(=O)OCCC
| PubChem CID | 121739 |
|---|---|
| CAS | 30673-60-0 |
| Molecular Weight (g/mol) | 214.349 |
| ChEBI | CHEBI:86973 |
| MDL Number | MFCD00056329 |
| SMILES | CCCCCCCCCC(=O)OCCC |
| Synonym | n-propyl decanoate,decanoic acid, propyl ester,propyl caprate,capric acid propyl ester,unii-s0he9grs1w,decanoic acid, propylester,s0he9grs1w,propyl caprate natural,propyl caprate decanoate,n-propyldecanoate |
| IUPAC Name | propyl decanoate |
| InChI Key | OVFMRFMJVFDSAA-UHFFFAOYSA-N |
| Molecular Formula | C13H26O2 |
Ethylene dimethacrylate, 98%, stabilized
CAS: 97-90-5 Molecular Formula: C10H14O4 Molecular Weight (g/mol): 198.22 MDL Number: MFCD00008590 InChI Key: STVZJERGLQHEKB-UHFFFAOYSA-N Synonym: ethylene glycol dimethacrylate,ethylene dimethacrylate,glycol dimethacrylate,diglycol dimethacrylate,ethanediol dimethacrylate,ethylenedimethyacrylate,ethylene methacrylate,ethyldiol metacrylate,1,2-bis methacryloyloxy ethane,ethylene glycol bis methacrylate PubChem CID: 7355 ChEBI: CHEBI:53436 SMILES: CC(=C)C(=O)OCCOC(=O)C(C)=C
| PubChem CID | 7355 |
|---|---|
| CAS | 97-90-5 |
| Molecular Weight (g/mol) | 198.22 |
| ChEBI | CHEBI:53436 |
| MDL Number | MFCD00008590 |
| SMILES | CC(=C)C(=O)OCCOC(=O)C(C)=C |
| Synonym | ethylene glycol dimethacrylate,ethylene dimethacrylate,glycol dimethacrylate,diglycol dimethacrylate,ethanediol dimethacrylate,ethylenedimethyacrylate,ethylene methacrylate,ethyldiol metacrylate,1,2-bis methacryloyloxy ethane,ethylene glycol bis methacrylate |
| InChI Key | STVZJERGLQHEKB-UHFFFAOYSA-N |
| Molecular Formula | C10H14O4 |
2,2,2-Trifluoroethyl Methacrylate (stabilized with MEHQ) 98.0+%, TCI America™
CAS: 352-87-4 Molecular Formula: C6H7F3O2 Molecular Weight (g/mol): 168.12 MDL Number: MFCD00013576,MFCD00274739 InChI Key: QTKPMCIBUROOGY-UHFFFAOYSA-N Synonym: 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z PubChem CID: 9608 IUPAC Name: 2,2,2-trifluoroethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(F)(F)F
| PubChem CID | 9608 |
|---|---|
| CAS | 352-87-4 |
| Molecular Weight (g/mol) | 168.12 |
| MDL Number | MFCD00013576,MFCD00274739 |
| SMILES | CC(=C)C(=O)OCC(F)(F)F |
| Synonym | 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z |
| IUPAC Name | 2,2,2-trifluoroethyl 2-methylprop-2-enoate |
| InChI Key | QTKPMCIBUROOGY-UHFFFAOYSA-N |
| Molecular Formula | C6H7F3O2 |
Ethyl 2-bromopropionate, 98+%
CAS: 535-11-5 Molecular Formula: C5H9BrO2 Molecular Weight (g/mol): 181.03 MDL Number: MFCD00000144 InChI Key: ARFLASKVLJTEJD-UHFFFAOYNA-N Synonym: ethyl 2-bromopropionate,ethyl alpha-bromopropionate,ethyl-2-bromopropionate,2-bromopropanoic acid ethyl ester,propanoic acid, 2-bromo-, ethyl ester,alpha-bromopropionic acid ethyl ester,ethyl a-bromopropionate,dl-ethyl 2-bromopropionate,2-bromopropionic acid ethyl ester,ethyl alpha-bromopropanoate PubChem CID: 79040 IUPAC Name: ethyl 2-bromopropanoate SMILES: CCOC(=O)C(C)Br
| PubChem CID | 79040 |
|---|---|
| CAS | 535-11-5 |
| Molecular Weight (g/mol) | 181.03 |
| MDL Number | MFCD00000144 |
| SMILES | CCOC(=O)C(C)Br |
| Synonym | ethyl 2-bromopropionate,ethyl alpha-bromopropionate,ethyl-2-bromopropionate,2-bromopropanoic acid ethyl ester,propanoic acid, 2-bromo-, ethyl ester,alpha-bromopropionic acid ethyl ester,ethyl a-bromopropionate,dl-ethyl 2-bromopropionate,2-bromopropionic acid ethyl ester,ethyl alpha-bromopropanoate |
| IUPAC Name | ethyl 2-bromopropanoate |
| InChI Key | ARFLASKVLJTEJD-UHFFFAOYNA-N |
| Molecular Formula | C5H9BrO2 |
Dimethyl fumarate, 99%
CAS: 624-49-7 Molecular Formula: C6H8O4 Molecular Weight (g/mol): 144.126 MDL Number: MFCD00064438 InChI Key: LDCRTTXIJACKKU-ONEGZZNKSA-N Synonym: dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate PubChem CID: 637568 ChEBI: CHEBI:76004 IUPAC Name: dimethyl (E)-but-2-enedioate SMILES: COC(=O)C=CC(=O)OC
| PubChem CID | 637568 |
|---|---|
| CAS | 624-49-7 |
| Molecular Weight (g/mol) | 144.126 |
| ChEBI | CHEBI:76004 |
| MDL Number | MFCD00064438 |
| SMILES | COC(=O)C=CC(=O)OC |
| Synonym | dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate |
| IUPAC Name | dimethyl (E)-but-2-enedioate |
| InChI Key | LDCRTTXIJACKKU-ONEGZZNKSA-N |
| Molecular Formula | C6H8O4 |
Methyl crotonate, 96%, trans-isomer
CAS: 623-43-8 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00009287 InChI Key: MCVVUJPXSBQTRZ-ONEGZZNKSA-N Synonym: methyl crotonate,e-methyl but-2-enoate,trans-methyl crotonate,methyl e-crotonate,methyl 2-butenoate,methyl trans-crotonate,2-butenoic acid, methyl ester, 2e,trans-2-butenoic acid methyl ester,methyl trans-2-butenoate,e-crotonic acid methyl ester PubChem CID: 638132 IUPAC Name: methyl (E)-but-2-enoate SMILES: COC(=O)\C=C\C
| PubChem CID | 638132 |
|---|---|
| CAS | 623-43-8 |
| Molecular Weight (g/mol) | 100.12 |
| MDL Number | MFCD00009287 |
| SMILES | COC(=O)\C=C\C |
| Synonym | methyl crotonate,e-methyl but-2-enoate,trans-methyl crotonate,methyl e-crotonate,methyl 2-butenoate,methyl trans-crotonate,2-butenoic acid, methyl ester, 2e,trans-2-butenoic acid methyl ester,methyl trans-2-butenoate,e-crotonic acid methyl ester |
| IUPAC Name | methyl (E)-but-2-enoate |
| InChI Key | MCVVUJPXSBQTRZ-ONEGZZNKSA-N |
| Molecular Formula | C5H8O2 |
Zinc acetate dihydrate, 97+%
CAS: 5970-45-6 Molecular Formula: C4H10O6Zn MDL Number: MFCD00066961 InChI Key: BEAZKUGSCHFXIQ-UHFFFAOYSA-L Synonym: zinc acetate dihydrate,zinc diacetate dihydrate,zinc ii acetate dihydrate,unii-fm5526k07a,acetic acid zinc salt,zinc acetate usp,acetic acid, zinc salt, dihydrate,zinc acetate, dihydrate,galzin tn PubChem CID: 2724192 IUPAC Name: zinc;diacetate;dihydrate
| PubChem CID | 2724192 |
|---|---|
| CAS | 5970-45-6 |
| MDL Number | MFCD00066961 |
| Synonym | zinc acetate dihydrate,zinc diacetate dihydrate,zinc ii acetate dihydrate,unii-fm5526k07a,acetic acid zinc salt,zinc acetate usp,acetic acid, zinc salt, dihydrate,zinc acetate, dihydrate,galzin tn |
| IUPAC Name | zinc;diacetate;dihydrate |
| InChI Key | BEAZKUGSCHFXIQ-UHFFFAOYSA-L |
| Molecular Formula | C4H10O6Zn |
Ethyl crotonate, 98%
CAS: 623-70-1 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.14 MDL Number: MFCD00009289 InChI Key: ZFDIRQKJPRINOQ-HWKANZROSA-N Synonym: ethyl crotonate,ethyl trans-crotonate,ethyl e-but-2-enoate,ethyl trans-2-butenoate,crotonic acid, ethyl ester,2-butenoic acid, ethyl ester, 2e,ethyl e-2-butenoate,2-butenoic acid, ethyl ester,ethyl 2e-but-2-enoate,crotonic acid, ethyl ester, e PubChem CID: 429065 IUPAC Name: ethyl (E)-but-2-enoate SMILES: CCOC(=O)\C=C\C
| PubChem CID | 429065 |
|---|---|
| CAS | 623-70-1 |
| Molecular Weight (g/mol) | 114.14 |
| MDL Number | MFCD00009289 |
| SMILES | CCOC(=O)\C=C\C |
| Synonym | ethyl crotonate,ethyl trans-crotonate,ethyl e-but-2-enoate,ethyl trans-2-butenoate,crotonic acid, ethyl ester,2-butenoic acid, ethyl ester, 2e,ethyl e-2-butenoate,2-butenoic acid, ethyl ester,ethyl 2e-but-2-enoate,crotonic acid, ethyl ester, e |
| IUPAC Name | ethyl (E)-but-2-enoate |
| InChI Key | ZFDIRQKJPRINOQ-HWKANZROSA-N |
| Molecular Formula | C6H10O2 |
Butyl p-toluenesulfonate, 99%
CAS: 778-28-9 Molecular Formula: C11H16O3S Molecular Weight (g/mol): 228.31 MDL Number: MFCD00027203 InChI Key: QYJXDIUNDMRLAO-UHFFFAOYSA-N Synonym: butyl p-toluenesulfonate,butyl tosylate,n-butyl p-toluenesulfonate,butyl p-methylbenzenesulfonate,butyl-p-toluenesulfonate,p-toluenesulfonic acid, butyl ester,benzenesulfonic acid, 4-methyl-, butyl ester,butyl toluene-4-sulphonate,p-toluenesulfonic acid n-butyl ester,p-toluene sulfonic acid, butyl ester PubChem CID: 13066 IUPAC Name: butyl 4-methylbenzenesulfonate SMILES: CCCCOS(=O)(=O)C1=CC=C(C)C=C1
| PubChem CID | 13066 |
|---|---|
| CAS | 778-28-9 |
| Molecular Weight (g/mol) | 228.31 |
| MDL Number | MFCD00027203 |
| SMILES | CCCCOS(=O)(=O)C1=CC=C(C)C=C1 |
| Synonym | butyl p-toluenesulfonate,butyl tosylate,n-butyl p-toluenesulfonate,butyl p-methylbenzenesulfonate,butyl-p-toluenesulfonate,p-toluenesulfonic acid, butyl ester,benzenesulfonic acid, 4-methyl-, butyl ester,butyl toluene-4-sulphonate,p-toluenesulfonic acid n-butyl ester,p-toluene sulfonic acid, butyl ester |
| IUPAC Name | butyl 4-methylbenzenesulfonate |
| InChI Key | QYJXDIUNDMRLAO-UHFFFAOYSA-N |
| Molecular Formula | C11H16O3S |
Ethylenebis(oxyethylenenitrilo)tetraacetic acid, 98%
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.34 MDL Number: MFCD00004291 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.34 |
| ChEBI | CHEBI:30740 |
| MDL Number | MFCD00004291 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |